CAS 749234-11-5 appears in our catalog under these names: Dmat, 95%, DMAT/ 99.58% (existing batch purity), DMAT, DMAT 99%, 4,5,6,7-Tetrabromo-N,N-dimethyl-1H-benzo[d]imidazol-2-amine, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 1mg.
4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine (CAS 749234-11-5) is a chemical compound with the molecular formula C9H7Br4N3 and a molecular weight of 476.79 g/mol. IUPAC name: 4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine. InChIKey: SLPJGDQJLTYWCI-UHFFFAOYSA-N.
| Molecular formula | C9H7Br4N3 |
|---|---|
| Molecular weight | 476.79 g/mol |
| IUPAC name | 4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine |
| InChIKey | SLPJGDQJLTYWCI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(N1)C(=C(C(=C2Br)Br)Br)Br |
Computed by PubChem (NCBI)