Products 749269-77-0
CAS 749269-77-0 is the registry number for CHF5022. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl]cyclopropane-1-carboxylic acid (CAS 749269-77-0) is a chemical compound with the molecular formula C17H12F4O2 and a molecular weight of 324.27 g/mol. IUPAC name: 1-[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl]cyclopropane-1-carboxylic acid. InChIKey: STSYUQWYKFKDNG-UHFFFAOYSA-N.
| Molecular formula | C17H12F4O2 |
|---|---|
| Molecular weight | 324.27 g/mol |
| IUPAC name | 1-[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | STSYUQWYKFKDNG-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)C3=CC=C(C=C3)C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)