Products 7493-81-4

CAS 7493-81-4 is the registry number for Phthalic acid, decylpentyl ester. Offered by: Dr. Ehrenstorfer. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-O-decyl 1-O-pentyl benzene-1,2-dicarboxylate (CAS 7493-81-4) is a chemical compound with the molecular formula C23H36O4 and a molecular weight of 376.5 g/mol. IUPAC name: 2-O-decyl 1-O-pentyl benzene-1,2-dicarboxylate. InChIKey: XHKLYUHRVRGLII-UHFFFAOYSA-N.

Identity
Molecular formulaC23H36O4
Molecular weight376.5 g/mol
IUPAC name2-O-decyl 1-O-pentyl benzene-1,2-dicarboxylate
InChIKeyXHKLYUHRVRGLII-UHFFFAOYSA-N
SMILESCCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCC

Computed by PubChem (NCBI)