CAS 74938-83-3 is the registry number for 2,2-Bis(4-hydroxyphenyl)hexafluoropropane, disodium salt, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Disodium;4-[1,1,1,3,3,3-hexafluoro-2-(4-oxidophenyl)propan-2-yl]phenolate (CAS 74938-83-3) is a chemical compound with the molecular formula C15H8F6Na2O2 and a molecular weight of 380.19 g/mol. IUPAC name: disodium;4-[1,1,1,3,3,3-hexafluoro-2-(4-oxidophenyl)propan-2-yl]phenolate. InChIKey: MGMXQPALCMNDKC-UHFFFAOYSA-L.
| Molecular formula | C15H8F6Na2O2 |
|---|---|
| Molecular weight | 380.19 g/mol |
| IUPAC name | disodium;4-[1,1,1,3,3,3-hexafluoro-2-(4-oxidophenyl)propan-2-yl]phenolate |
| InChIKey | MGMXQPALCMNDKC-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)[O-])(C(F)(F)F)C(F)(F)F)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)