Products 7495-45-6

CAS 7495-45-6 is the registry number for Ethoxy(diphenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-ethoxy-2,2-diphenylacetic acid (CAS 7495-45-6) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-ethoxy-2,2-diphenylacetic acid. InChIKey: SEUTWLXKEMEBTR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O3
Molecular weight256.30 g/mol
IUPAC name2-ethoxy-2,2-diphenylacetic acid
InChIKeySEUTWLXKEMEBTR-UHFFFAOYSA-N
SMILESCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)