CAS 749786-16-1 is the registry number for Perfluoroundecanesulfonic acid. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecane-1-sulfonic acid (CAS 749786-16-1) is a chemical compound with the molecular formula C11HF23O3S and a molecular weight of 650.15 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecane-1-sulfonic acid. InChIKey: UKHUPOMCGUFNAP-UHFFFAOYSA-N.
| Molecular formula | C11HF23O3S |
|---|---|
| Molecular weight | 650.15 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecane-1-sulfonic acid |
| InChIKey | UKHUPOMCGUFNAP-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)