CAS 749906-95-4 appears in our catalog under these names: 2-Cyano-n-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide, 95%, 2-Cyano-N-(4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl)acetamide, 95%, 2-Cyano-N-(4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-cyano-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide (CAS 749906-95-4) is a chemical compound with the molecular formula C12H7Cl2N3OS and a molecular weight of 312.2 g/mol. IUPAC name: 2-cyano-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide. InChIKey: QUPOSZQQMSHEQS-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3OS |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | 2-cyano-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | QUPOSZQQMSHEQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CSC(=N2)NC(=O)CC#N |
Computed by PubChem (NCBI)