Products 749917-24-6

CAS 749917-24-6 is the registry number for Diethyl 2-(3-fluoro-4-iodophenyl)-2-methylmalonate. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 2-(3-fluoro-4-iodophenyl)-2-methylpropanedioate (CAS 749917-24-6) is a chemical compound with the molecular formula C14H16FIO4 and a molecular weight of 394.18 g/mol. IUPAC name: diethyl 2-(3-fluoro-4-iodophenyl)-2-methylpropanedioate. InChIKey: WJAXZUKSFUMXNP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16FIO4
Molecular weight394.18 g/mol
IUPAC namediethyl 2-(3-fluoro-4-iodophenyl)-2-methylpropanedioate
InChIKeyWJAXZUKSFUMXNP-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C1=CC(=C(C=C1)I)F)C(=O)OCC

Computed by PubChem (NCBI)