CAS 749917-24-6 is the registry number for Diethyl 2-(3-fluoro-4-iodophenyl)-2-methylmalonate. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g.
Diethyl 2-(3-fluoro-4-iodophenyl)-2-methylpropanedioate (CAS 749917-24-6) is a chemical compound with the molecular formula C14H16FIO4 and a molecular weight of 394.18 g/mol. IUPAC name: diethyl 2-(3-fluoro-4-iodophenyl)-2-methylpropanedioate. InChIKey: WJAXZUKSFUMXNP-UHFFFAOYSA-N.
| Molecular formula | C14H16FIO4 |
|---|---|
| Molecular weight | 394.18 g/mol |
| IUPAC name | diethyl 2-(3-fluoro-4-iodophenyl)-2-methylpropanedioate |
| InChIKey | WJAXZUKSFUMXNP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C1=CC(=C(C=C1)I)F)C(=O)OCC |
Computed by PubChem (NCBI)