CAS 749928-77-6 appears in our catalog under these names: 2-(4-Bromo-2-fluorophenyl)-2-methylpropanenitrile, 96%, 2-(4-Bromo-2-fluorophenyl)-2-methylpropanenitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
2-(4-bromo-2-fluorophenyl)-2-methylpropanenitrile (CAS 749928-77-6) is a chemical compound with the molecular formula C10H9BrFN and a molecular weight of 242.09 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-2-methylpropanenitrile. InChIKey: WPCTXASXKDFYBT-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFN |
|---|---|
| Molecular weight | 242.09 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-2-methylpropanenitrile |
| InChIKey | WPCTXASXKDFYBT-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)