Products 75001-83-1

CAS 75001-83-1 is the registry number for Norfloxacin Methyl Ester. Offered by: Chemat Brand, Mikromol, Biosynth. Available pack sizes: on request, 25mg, 100mg.

Structural formula: {0} (CAS {1})

Methyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate (CAS 75001-83-1) is a chemical compound with the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. IUPAC name: methyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate. InChIKey: MECQXLLOIWHERD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20FN3O3
Molecular weight333.36 g/mol
IUPAC namemethyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate
InChIKeyMECQXLLOIWHERD-UHFFFAOYSA-N
SMILESCCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)OC

Computed by PubChem (NCBI)