Products 750586-15-3

CAS 750586-15-3 is the registry number for (2,4-Dimethoxy-3-methylphenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,4-dimethoxy-3-methylphenyl)boronic acid (CAS 750586-15-3) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: (2,4-dimethoxy-3-methylphenyl)boronic acid. InChIKey: GANVGNZHKDWRKN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BO4
Molecular weight196.01 g/mol
IUPAC name(2,4-dimethoxy-3-methylphenyl)boronic acid
InChIKeyGANVGNZHKDWRKN-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OC)C)OC)(O)O

Computed by PubChem (NCBI)