CAS 750599-01-0 appears in our catalog under these names: 5,6-Dihydro-4h-cyclopenta[b]thiophene-2-carbohydrazide, 95%, 5,6-Dihydro-4H-cyclopenta(b)thiophene-2-carbohydrazide, 95+%, 5,6-Dihydro-4H-cyclopenta(b)thiophene-2-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,5g.
5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide (CAS 750599-01-0) is a chemical compound with the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. IUPAC name: 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide. InChIKey: PNALDFYPMMIOAR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2OS |
|---|---|
| Molecular weight | 182.25 g/mol |
| IUPAC name | 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
| InChIKey | PNALDFYPMMIOAR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2)C(=O)NN |
Computed by PubChem (NCBI)