Products 750611-26-8

CAS 750611-26-8 is the registry number for 2,4-Dimethyl 5-(chlorosulfonyl)-3-methylthiophene-2,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Dimethyl 5-chlorosulfonyl-3-methylthiophene-2,4-dicarboxylate (CAS 750611-26-8) is a chemical compound with the molecular formula C9H9ClO6S2 and a molecular weight of 312.8 g/mol. IUPAC name: dimethyl 5-chlorosulfonyl-3-methylthiophene-2,4-dicarboxylate. InChIKey: YITRJBAARVGBBF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO6S2
Molecular weight312.8 g/mol
IUPAC namedimethyl 5-chlorosulfonyl-3-methylthiophene-2,4-dicarboxylate
InChIKeyYITRJBAARVGBBF-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1C(=O)OC)S(=O)(=O)Cl)C(=O)OC

Computed by PubChem (NCBI)