CAS 750611-26-8 is the registry number for 2,4-Dimethyl 5-(chlorosulfonyl)-3-methylthiophene-2,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Dimethyl 5-chlorosulfonyl-3-methylthiophene-2,4-dicarboxylate (CAS 750611-26-8) is a chemical compound with the molecular formula C9H9ClO6S2 and a molecular weight of 312.8 g/mol. IUPAC name: dimethyl 5-chlorosulfonyl-3-methylthiophene-2,4-dicarboxylate. InChIKey: YITRJBAARVGBBF-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO6S2 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | dimethyl 5-chlorosulfonyl-3-methylthiophene-2,4-dicarboxylate |
| InChIKey | YITRJBAARVGBBF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC)S(=O)(=O)Cl)C(=O)OC |
Computed by PubChem (NCBI)