CAS 750635-93-9 is the registry number for (4S,7S)-4,7-Dimethyl-1,3,2-dioxathiepane 2-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,7S)-4,7-dimethyl-1,3,2-dioxathiepane 2-oxide (CAS 750635-93-9) is a chemical compound with the molecular formula C6H12O3S and a molecular weight of 164.22 g/mol. IUPAC name: (4S,7S)-4,7-dimethyl-1,3,2-dioxathiepane 2-oxide. InChIKey: SDFLVSQSOFUGLR-WDSKDSINSA-N.
| Molecular formula | C6H12O3S |
|---|---|
| Molecular weight | 164.22 g/mol |
| IUPAC name | (4S,7S)-4,7-dimethyl-1,3,2-dioxathiepane 2-oxide |
| InChIKey | SDFLVSQSOFUGLR-WDSKDSINSA-N |
| SMILES | C[C@H]1CC[C@@H](OS(=O)O1)C |
Computed by PubChem (NCBI)