CAS 751-38-2 appears in our catalog under these names: 1,2,3,4-Tetraphenylnaphthalene, 95%, 1,2,3,4-TETRAPHENYLNAPHTHALENE, 97%, 1,2,3,4-Tetraphenylnaphthalene, 97%, 97%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1,2,3,4-tetraphenylnaphthalene (CAS 751-38-2) is a chemical compound with the molecular formula C34H24 and a molecular weight of 432.6 g/mol. IUPAC name: 1,2,3,4-tetraphenylnaphthalene. InChIKey: UCTTYTFENYGAPP-UHFFFAOYSA-N.
| Molecular formula | C34H24 |
|---|---|
| Molecular weight | 432.6 g/mol |
| IUPAC name | 1,2,3,4-tetraphenylnaphthalene |
| InChIKey | UCTTYTFENYGAPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C3=CC=CC=C32)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)