CAS 75130-24-4 appears in our catalog under these names: Lercanidipine Impurity 25, Lercanidipine Impurity 2, 1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic Acid 3-(2-Cyanoethyl) 5-Methyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
5-O-(2-cyanoethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 75130-24-4) is a chemical compound with the molecular formula C19H19N3O6 and a molecular weight of 385.4 g/mol. IUPAC name: 5-O-(2-cyanoethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: PVYKGJCGTZQNJL-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O6 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 5-O-(2-cyanoethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | PVYKGJCGTZQNJL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCC#N)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)