Products 751471-48-4
CAS 751471-48-4 is the registry number for Histamine-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,1,2,2-tetradeuterio-2-(1H-imidazol-5-yl)ethanamine (CAS 751471-48-4) is a chemical compound with the molecular formula C5H9N3 and a molecular weight of 115.17 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(1H-imidazol-5-yl)ethanamine. InChIKey: NTYJJOPFIAHURM-LNLMKGTHSA-N.
| Molecular formula | C5H9N3 |
|---|---|
| Molecular weight | 115.17 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(1H-imidazol-5-yl)ethanamine |
| InChIKey | NTYJJOPFIAHURM-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C1=CN=CN1)C([2H])([2H])N |
Computed by PubChem (NCBI)