CAS 7515-73-3 is the registry number for 4-Biphenylylchlorophenylmethane, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
1-[chloro(phenyl)methyl]-4-phenylbenzene (CAS 7515-73-3) is a chemical compound with the molecular formula C19H15Cl and a molecular weight of 278.8 g/mol. IUPAC name: 1-[chloro(phenyl)methyl]-4-phenylbenzene. InChIKey: HSVIAUJGCMPSQO-UHFFFAOYSA-N.
| Molecular formula | C19H15Cl |
|---|---|
| Molecular weight | 278.8 g/mol |
| IUPAC name | 1-[chloro(phenyl)methyl]-4-phenylbenzene |
| InChIKey | HSVIAUJGCMPSQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)