CAS 75160-24-6 is the registry number for Pinacol-d12. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg.
1,1,1,4,4,4-hexadeuterio-2,3-bis(trideuteriomethyl)butane-2,3-diol (CAS 75160-24-6) is a chemical compound with the molecular formula C6H14O2 and a molecular weight of 130.25 g/mol. IUPAC name: 1,1,1,4,4,4-hexadeuterio-2,3-bis(trideuteriomethyl)butane-2,3-diol. InChIKey: IVDFJHOHABJVEH-MGKWXGLJSA-N.
| Molecular formula | C6H14O2 |
|---|---|
| Molecular weight | 130.25 g/mol |
| IUPAC name | 1,1,1,4,4,4-hexadeuterio-2,3-bis(trideuteriomethyl)butane-2,3-diol |
| InChIKey | IVDFJHOHABJVEH-MGKWXGLJSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O)O |
Computed by PubChem (NCBI)