CAS 75179-29-2 appears in our catalog under these names: Boc-Cys(Trt)-Osu, Boc–Cys(Trt)–OSu, Boc-Cys(Trt)-OSu 96%, Boc-Cys(Trt)-OSu, 97%, 97%, Boc-Cys(Trt)-OSu, 96%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 1g, 10g, 25g, 100g, 250mg.
(2,5-dioxopyrrolidin-1-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoate (CAS 75179-29-2) is a chemical compound with the molecular formula C31H32N2O6S and a molecular weight of 560.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoate. InChIKey: JIXAKJALBJDZTP-VWLOTQADSA-N.
| Molecular formula | C31H32N2O6S |
|---|---|
| Molecular weight | 560.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoate |
| InChIKey | JIXAKJALBJDZTP-VWLOTQADSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)ON4C(=O)CCC4=O |
Computed by PubChem (NCBI)