Products 75184-94-0
CAS 75184-94-0 is the registry number for Fenprinast. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(4-chlorophenyl)methyl]-6,6-dimethyl-1,7-dihydroimidazo[1,2-a]purin-9-one (CAS 75184-94-0) is a chemical compound with the molecular formula C16H16ClN5O and a molecular weight of 329.78 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl]-6,6-dimethyl-1,7-dihydroimidazo[1,2-a]purin-9-one. InChIKey: MXEAHCWVILOHDC-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN5O |
|---|---|
| Molecular weight | 329.78 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methyl]-6,6-dimethyl-1,7-dihydroimidazo[1,2-a]purin-9-one |
| InChIKey | MXEAHCWVILOHDC-UHFFFAOYSA-N |
| SMILES | CC1(CN2C(=O)C3=C(N=CN3)N(C2=N1)CC4=CC=C(C=C4)Cl)C |
Computed by PubChem (NCBI)