CAS 75188-89-5 is the registry number for H-Pro-Leu-Gly-Gly-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 250mg, 500mg, 1000mg.
2-[[2-[[(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]amino]acetic acid (CAS 75188-89-5) is a chemical compound with the molecular formula C15H26N4O5 and a molecular weight of 342.39 g/mol. IUPAC name: 2-[[2-[[(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]amino]acetic acid. InChIKey: IYZOXDNRXYWQCI-QWRGUYRKSA-N.
| Molecular formula | C15H26N4O5 |
|---|---|
| Molecular weight | 342.39 g/mol |
| IUPAC name | 2-[[2-[[(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]amino]acetic acid |
| InChIKey | IYZOXDNRXYWQCI-QWRGUYRKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC(=O)NCC(=O)O)NC(=O)[C@@H]1CCCN1 |
Computed by PubChem (NCBI)