CAS 7520-92-5 appears in our catalog under these names: 2',4'-Dimethyl-(4,5'-bithiazol)-2-amine, 95%, 4-(Dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine (CAS 7520-92-5) is a chemical compound with the molecular formula C8H9N3S2 and a molecular weight of 211.3 g/mol. IUPAC name: 4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine. InChIKey: MQRVWXNHZWZVMR-UHFFFAOYSA-N.
| Molecular formula | C8H9N3S2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine |
| InChIKey | MQRVWXNHZWZVMR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)