Products 752135-37-8

CAS 752135-37-8 appears in our catalog under these names: 6-Chloro-3-methyl-1-benzothiophene-2-sulfonyl chloride, 95%, 6-Chloro-3-methyl-1-benzothiophene-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

6-chloro-3-methyl-1-benzothiophene-2-sulfonyl chloride (CAS 752135-37-8) is a chemical compound with the molecular formula C9H6Cl2O2S2 and a molecular weight of 281.2 g/mol. IUPAC name: 6-chloro-3-methyl-1-benzothiophene-2-sulfonyl chloride. InChIKey: DYRASNHESMAQAI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Cl2O2S2
Molecular weight281.2 g/mol
IUPAC name6-chloro-3-methyl-1-benzothiophene-2-sulfonyl chloride
InChIKeyDYRASNHESMAQAI-UHFFFAOYSA-N
SMILESCC1=C(SC2=C1C=CC(=C2)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)