CAS 75228-96-5 appears in our catalog under these names: 2-Chloro-N-{(5-(4-chlorophenyl)furan-2-yl)methyl}-N-methylacetamide, 95%, 2-Chloro-N-{(5-(4-chlorophenyl)furan-2-yl)methyl}-N-methylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methylacetamide (CAS 75228-96-5) is a chemical compound with the molecular formula C14H13Cl2NO2 and a molecular weight of 298.2 g/mol. IUPAC name: 2-chloro-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methylacetamide. InChIKey: CQGJQPJILYDHCL-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2NO2 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | 2-chloro-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methylacetamide |
| InChIKey | CQGJQPJILYDHCL-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(O1)C2=CC=C(C=C2)Cl)C(=O)CCl |
Computed by PubChem (NCBI)