CAS 75230-50-1 appears in our catalog under these names: N'-[(1E)-1-(4-chlorophenyl)ethylidene]-4-methylbenzene-1-sulfonohydrazide, 97%, 97%, N'–(1–(4–Chlorophenyl)ethylidene)–4–methylbenzenesulfonohydrazide. Offered by: Chemat, GLPBio. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-4-methylbenzenesulfonamide (CAS 75230-50-1) is a chemical compound with the molecular formula C15H15ClN2O2S and a molecular weight of 322.8 g/mol. IUPAC name: N-[(E)-1-(4-chlorophenyl)ethylideneamino]-4-methylbenzenesulfonamide. InChIKey: LXTKFUSDWSCUJN-SFQUDFHCSA-N.
| Molecular formula | C15H15ClN2O2S |
|---|---|
| Molecular weight | 322.8 g/mol |
| IUPAC name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | LXTKFUSDWSCUJN-SFQUDFHCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C(\C)/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)