CAS 75265-85-9 appears in our catalog under these names: 2-Oxocyclohexanecarboxylic acid sodium salt, 95%, 2-Oxocyclohexanecarboxylic acid sodium salt, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
Sodium 2-oxocyclohexane-1-carboxylate (CAS 75265-85-9) is a chemical compound with the molecular formula C7H9NaO3 and a molecular weight of 164.13 g/mol. IUPAC name: sodium 2-oxocyclohexane-1-carboxylate. InChIKey: SQOTYYYBCYURDK-UHFFFAOYSA-M.
| Molecular formula | C7H9NaO3 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | sodium 2-oxocyclohexane-1-carboxylate |
| InChIKey | SQOTYYYBCYURDK-UHFFFAOYSA-M |
| SMILES | C1CCC(=O)C(C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)