CAS 75277-36-0 is the registry number for 1,1′-Sulfonylbis[3,5-dichlorobenzene], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dichloro-5-(3,5-dichlorophenyl)sulfonylbenzene (CAS 75277-36-0) is a chemical compound with the molecular formula C12H6Cl4O2S and a molecular weight of 356.0 g/mol. IUPAC name: 1,3-dichloro-5-(3,5-dichlorophenyl)sulfonylbenzene. InChIKey: IBHGHNFGHAWRIK-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4O2S |
|---|---|
| Molecular weight | 356.0 g/mol |
| IUPAC name | 1,3-dichloro-5-(3,5-dichlorophenyl)sulfonylbenzene |
| InChIKey | IBHGHNFGHAWRIK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)S(=O)(=O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)