CAS 75317-42-9 is the registry number for N,N'-Bis-(3,5-dichloro-phenyl)-malonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N,N'-bis(3,5-dichlorophenyl)propanediamide (CAS 75317-42-9) is a chemical compound with the molecular formula C15H10Cl4N2O2 and a molecular weight of 392.1 g/mol. IUPAC name: N,N'-bis(3,5-dichlorophenyl)propanediamide. InChIKey: HTPQMIJQFRJNLH-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl4N2O2 |
|---|---|
| Molecular weight | 392.1 g/mol |
| IUPAC name | N,N'-bis(3,5-dichlorophenyl)propanediamide |
| InChIKey | HTPQMIJQFRJNLH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)NC(=O)CC(=O)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)