CAS 75321-19-6 is the registry number for 1,3,6-Trinitropyrene, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
1,3,6-trinitropyrene (CAS 75321-19-6) is a chemical compound with the molecular formula C16H7N3O6 and a molecular weight of 337.24 g/mol. IUPAC name: 1,3,6-trinitropyrene. InChIKey: BXOXVTWMJCUYLW-UHFFFAOYSA-N.
| Molecular formula | C16H7N3O6 |
|---|---|
| Molecular weight | 337.24 g/mol |
| IUPAC name | 1,3,6-trinitropyrene |
| InChIKey | BXOXVTWMJCUYLW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C(C=C2[N+](=O)[O-])[N+](=O)[O-])C=CC4=C(C=CC1=C43)[N+](=O)[O-] |
Computed by PubChem (NCBI)