Products 753468-25-6
CAS 753468-25-6 is the registry number for Casein kinase 1δ-IN-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CAS 753468-25-6) is a chemical compound with the molecular formula C20H14FN3O4S2 and a molecular weight of 443.5 g/mol. IUPAC name: N-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide. InChIKey: FBVJVMGLAZCAFI-UHFFFAOYSA-N.
| Molecular formula | C20H14FN3O4S2 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | N-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| InChIKey | FBVJVMGLAZCAFI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)NC3=C4C(=CSC4=NC=N3)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)
Synonyms:
Casein kinase 1|A-IN-25, orb2945849