CAS 753475-22-8 is the registry number for tert-Butyl (4'-amino-3,3'-dimethyl-(1,1'-biphenyl)-4-yl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 10g.
Tert-butyl N-[4-(4-amino-3-methylphenyl)-2-methylphenyl]carbamate (CAS 753475-22-8) is a chemical compound with the molecular formula C19H24N2O2 and a molecular weight of 312.4 g/mol. IUPAC name: tert-butyl N-[4-(4-amino-3-methylphenyl)-2-methylphenyl]carbamate. InChIKey: QCWAUJLKNBIPMY-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | tert-butyl N-[4-(4-amino-3-methylphenyl)-2-methylphenyl]carbamate |
| InChIKey | QCWAUJLKNBIPMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)NC(=O)OC(C)(C)C)C)N |
Computed by PubChem (NCBI)