CAS 753500-02-6 is the registry number for NS-6740. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,4-diazabicyclo[3.2.2]nonan-4-yl-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone (CAS 753500-02-6) is a chemical compound with the molecular formula C19H19F3N2O2 and a molecular weight of 364.4 g/mol. IUPAC name: 1,4-diazabicyclo[3.2.2]nonan-4-yl-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone. InChIKey: VSOWCIMCDKXVRC-UHFFFAOYSA-N.
| Molecular formula | C19H19F3N2O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 1,4-diazabicyclo[3.2.2]nonan-4-yl-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone |
| InChIKey | VSOWCIMCDKXVRC-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1N(CC2)C(=O)C3=CC=C(O3)C4=CC(=CC=C4)C(F)(F)F |
Computed by PubChem (NCBI)