CAS 7536-59-6 appears in our catalog under these names: Boc-glu(obzl)-onp, 98%, Boc-Glu(OBzl)-ONp, 97%, Boc–Glu(OBzl)–ONp, Boc-L-Glu(OBzl)-ONp. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech. Available pack sizes: 5g, 25g, 1g.
5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 7536-59-6) is a chemical compound with the molecular formula C23H26N2O8 and a molecular weight of 458.5 g/mol. IUPAC name: 5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: FWDKXKMKRUDOMG-IBGZPJMESA-N.
| Molecular formula | C23H26N2O8 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | 5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | FWDKXKMKRUDOMG-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OCC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)