CAS 75369-63-0 is the registry number for Flunixin Methyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Methyl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate (CAS 75369-63-0) is a chemical compound with the molecular formula C15H13F3N2O2 and a molecular weight of 310.27 g/mol. IUPAC name: methyl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate. InChIKey: YKASBHLSNBJQJF-UHFFFAOYSA-N.
| Molecular formula | C15H13F3N2O2 |
|---|---|
| Molecular weight | 310.27 g/mol |
| IUPAC name | methyl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| InChIKey | YKASBHLSNBJQJF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC2=C(C=CC=N2)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)