Products 75369-63-0

CAS 75369-63-0 is the registry number for Flunixin Methyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Methyl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate (CAS 75369-63-0) is a chemical compound with the molecular formula C15H13F3N2O2 and a molecular weight of 310.27 g/mol. IUPAC name: methyl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate. InChIKey: YKASBHLSNBJQJF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13F3N2O2
Molecular weight310.27 g/mol
IUPAC namemethyl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate
InChIKeyYKASBHLSNBJQJF-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1NC2=C(C=CC=N2)C(=O)OC)C(F)(F)F

Computed by PubChem (NCBI)