CAS 7541-76-6 appears in our catalog under these names: 4-Formyl-n,n,n-trimethylbenzenaminium iodide, 98%, 4-Formyl-N,N,N-trimethylbenzenaminium iodide 97%, 4-Formyl-n,n,n-trimethylbenzenaminium iodide, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g.
(4-formylphenyl)-trimethylazanium iodide (CAS 7541-76-6) is a chemical compound with the molecular formula C10H14INO and a molecular weight of 291.13 g/mol. IUPAC name: (4-formylphenyl)-trimethylazanium iodide. InChIKey: AHWRLQSSGMGGFR-UHFFFAOYSA-M.
| Molecular formula | C10H14INO |
|---|---|
| Molecular weight | 291.13 g/mol |
| IUPAC name | (4-formylphenyl)-trimethylazanium iodide |
| InChIKey | AHWRLQSSGMGGFR-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1=CC=C(C=C1)C=O.[I-] |
Computed by PubChem (NCBI)