CAS 75464-52-7 appears in our catalog under these names: 2,5–Diamino–1,4–benzenedithiol Dihydrochloride, 2,5-diamino-1,4-benzenedithiol, 2,5-Diamino-1,4-benzenedithiol Dihydrochloride, >97.0%(HPLC), 2,5-Diaminobenzene-1,4-dithiol dihydrochloride, 97% HPLC, 97% HPLC, 2,5-Diamino-1,4-benzenedithiol dihydrochloride, 97%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100g, 10g.
2,5-diaminobenzene-1,4-dithiol;dihydrochloride (CAS 75464-52-7) is a chemical compound with the molecular formula C6H10Cl2N2S2 and a molecular weight of 245.2 g/mol. IUPAC name: 2,5-diaminobenzene-1,4-dithiol;dihydrochloride. InChIKey: HVXLKRWRWNFGBA-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl2N2S2 |
|---|---|
| Molecular weight | 245.2 g/mol |
| IUPAC name | 2,5-diaminobenzene-1,4-dithiol;dihydrochloride |
| InChIKey | HVXLKRWRWNFGBA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S)N)S)N.Cl.Cl |
Computed by PubChem (NCBI)