CAS 75500-02-6 is the registry number for 1,3-Dibenzyl-5-fluorouracil. Offered by: TRC, MedChemExpress. Available pack sizes: 1g, 2g, 5g, 50 mg, 100 mg, 5 g, 1 g.
1,3-dibenzyl-5-fluoropyrimidine-2,4-dione (CAS 75500-02-6) is a chemical compound with the molecular formula C18H15FN2O2 and a molecular weight of 310.3 g/mol. IUPAC name: 1,3-dibenzyl-5-fluoropyrimidine-2,4-dione. InChIKey: QVRHSLFHSJNNKP-UHFFFAOYSA-N.
| Molecular formula | C18H15FN2O2 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 1,3-dibenzyl-5-fluoropyrimidine-2,4-dione |
| InChIKey | QVRHSLFHSJNNKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C(=O)N(C2=O)CC3=CC=CC=C3)F |
Computed by PubChem (NCBI)