Products 755039-49-7
CAS 755039-49-7 is the registry number for (R)-2-chloro-8-cyclopentyl-7-methyl-7,8-dihydropteridin-6(5H)-one, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(7R)-2-chloro-8-cyclopentyl-7-methyl-5,7-dihydropteridin-6-one (CAS 755039-49-7) is a chemical compound with the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. IUPAC name: (7R)-2-chloro-8-cyclopentyl-7-methyl-5,7-dihydropteridin-6-one. InChIKey: IBNRVNCIECLLGE-SSDOTTSWSA-N.
| Molecular formula | C12H15ClN4O |
|---|---|
| Molecular weight | 266.73 g/mol |
| IUPAC name | (7R)-2-chloro-8-cyclopentyl-7-methyl-5,7-dihydropteridin-6-one |
| InChIKey | IBNRVNCIECLLGE-SSDOTTSWSA-N |
| SMILES | C[C@@H]1C(=O)NC2=CN=C(N=C2N1C3CCCC3)Cl |
Computed by PubChem (NCBI)