Products 755039-56-6
CAS 755039-56-6 appears in our catalog under these names: (R)-4-(8-Cyclopentyl-7-ethyl-5-methyl-6-oxo-5,6,7,8-tetrahydro-pteridin-2-ylamino) -3-methoxy-benzoic acid, dTAG Targeting Ligand 1, 98.0%, dTAG Targeting Ligand 1, 98%, dTAG Targeting Ligand 1, 95%, (R)-4-((8-Cyclopentyl-7-ethyl-5-methyl-6-oxo-5，6，7，8-tetrahydropteridin-2-yl)amino)-3-methoxybenzoic acid, 98%. Offered by: Biosynth, MedChemExpress, Fluorochem, Ambeed, Chemat. Available pack sizes: 50mg, 50 mg, 100 mg, 25 mg, 10 mg, 100mg, 250mg, 1g.
4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoic acid (CAS 755039-56-6) is a chemical compound with the molecular formula C22H27N5O4 and a molecular weight of 425.5 g/mol. IUPAC name: 4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoic acid. InChIKey: AMLPCXFISSPPBJ-MRXNPFEDSA-N.
| Molecular formula | C22H27N5O4 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoic acid |
| InChIKey | AMLPCXFISSPPBJ-MRXNPFEDSA-N |
| SMILES | CC[C@@H]1C(=O)N(C2=CN=C(N=C2N1C3CCCC3)NC4=C(C=C(C=C4)C(=O)O)OC)C |
Computed by PubChem (NCBI)