CAS 75507-68-5 appears in our catalog under these names: Flupirtine Maleate, Flupirtine maleate, Flupirtine maleate/ 99.5% (existing batch purity), Flupirtine maleate - Bio-X â„¢, Flupirtine Maleate Salt, >98.0%(HPLC)(T). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, GLPBio. Available pack sizes: on request, 100mg, 250mg, 25mg, 10mg, 1g, 10mM (in 1ml dmso), 50mg.
(Z)-but-2-enedioic acid;ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate (CAS 75507-68-5) is a chemical compound with the molecular formula C19H21FN4O6 and a molecular weight of 420.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate. InChIKey: DPYIXBFZUMCMJM-BTJKTKAUSA-N.
| Molecular formula | C19H21FN4O6 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
| InChIKey | DPYIXBFZUMCMJM-BTJKTKAUSA-N |
| SMILES | CCOC(=O)NC1=C(N=C(C=C1)NCC2=CC=C(C=C2)F)N.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)