CAS 75524-10-6 appears in our catalog under these names: Clobazam USP Related Compound G, 5-chloro-1,2-dimethyl-3-phenyl-1,2-dihydrobenzimidazol-1-ium,chloride, 6-Chloro-2,3-dimethyl-1-phenyl-1H-benzo(d)imidazol-3-ium Chloride, >95% (HPLC), CLOBAZAM RELATED COMPOUND G. Offered by: Chemat Brand, Hubei YoungXin, TRC, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
5-chloro-1,2-dimethyl-3-phenylbenzimidazol-1-ium chloride (CAS 75524-10-6) is a chemical compound with the molecular formula C15H14Cl2N2 and a molecular weight of 293.2 g/mol. IUPAC name: 5-chloro-1,2-dimethyl-3-phenylbenzimidazol-1-ium chloride. InChIKey: VKKYWEDLYZLADD-UHFFFAOYSA-M.
| Molecular formula | C15H14Cl2N2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 5-chloro-1,2-dimethyl-3-phenylbenzimidazol-1-ium chloride |
| InChIKey | VKKYWEDLYZLADD-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C2=C(N1C3=CC=CC=C3)C=C(C=C2)Cl)C.[Cl-] |
Computed by PubChem (NCBI)