CAS 75556-46-6 is the registry number for (1S,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-yl 2-chloroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-chloroacetate (CAS 75556-46-6) is a chemical compound with the molecular formula C12H19ClO2 and a molecular weight of 230.73 g/mol. IUPAC name: [(1S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-chloroacetate. InChIKey: VSQKDAUZKNYBHR-SHVIVCPWSA-N.
| Molecular formula | C12H19ClO2 |
|---|---|
| Molecular weight | 230.73 g/mol |
| IUPAC name | [(1S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-chloroacetate |
| InChIKey | VSQKDAUZKNYBHR-SHVIVCPWSA-N |
| SMILES | C[C@]12CCC(C1(C)C)CC2OC(=O)CCl |
Computed by PubChem (NCBI)