CAS 75575-50-7 appears in our catalog under these names: Lithium salicylate monohydrate, 98%, Lithium Salicylate Monohydrate, 98% HPLC,T. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
Lithium;2-hydroxybenzoate;hydrate (CAS 75575-50-7) is a chemical compound with the molecular formula C7H7LiO4 and a molecular weight of 162.1 g/mol. IUPAC name: lithium;2-hydroxybenzoate;hydrate. InChIKey: SKQWWJVTSPXPSF-UHFFFAOYSA-M.
| Molecular formula | C7H7LiO4 |
|---|---|
| Molecular weight | 162.1 g/mol |
| IUPAC name | lithium;2-hydroxybenzoate;hydrate |
| InChIKey | SKQWWJVTSPXPSF-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC=C(C(=C1)C(=O)[O-])O.O |
Computed by PubChem (NCBI)