CAS 756-88-7 is the registry number for Bis(1,1,1,2,3,3,3-heptafluoro-2-propanyl)mercury. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
Bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)mercury (CAS 756-88-7) is a chemical compound with the molecular formula C6F14Hg and a molecular weight of 538.63 g/mol. IUPAC name: bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)mercury. InChIKey: HWWMRIRERNSEIZ-UHFFFAOYSA-N.
| Molecular formula | C6F14Hg |
|---|---|
| Molecular weight | 538.63 g/mol |
| IUPAC name | bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)mercury |
| InChIKey | HWWMRIRERNSEIZ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)(F)[Hg]C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)