CAS 75614-89-0 appears in our catalog under these names: R(-)-alpha-Methyl Histamine Dihydrochloride, >95% (HPLC), R(-)-a-Methyl Histamine Dihydrochloride, >95% (HPLC), R–(–)–α–Methylhistamine (hydrochloride), (R)-1-(1H-Imidazol-4-yl)propan-2-amine dihydrochloride, 98%, 98%, (R)-(-)-α-Methylhistamine (dihydrochloride), 99.76%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 25mg, 5mg, 1mg, 10mg, 10 mg, 5 mg.
(2R)-1-(1H-imidazol-5-yl)propan-2-amine;dihydrochloride (CAS 75614-89-0) is a chemical compound with the molecular formula C6H13Cl2N3 and a molecular weight of 198.09 g/mol. IUPAC name: (2R)-1-(1H-imidazol-5-yl)propan-2-amine;dihydrochloride. InChIKey: IZHCNQFUWDFPCW-ZJIMSODOSA-N.
| Molecular formula | C6H13Cl2N3 |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | (2R)-1-(1H-imidazol-5-yl)propan-2-amine;dihydrochloride |
| InChIKey | IZHCNQFUWDFPCW-ZJIMSODOSA-N |
| SMILES | C[C@H](CC1=CN=CN1)N.Cl.Cl |
Computed by PubChem (NCBI)