Products 75638-59-4
CAS 75638-59-4 is the registry number for (2S,3R)-3-Amino-2-hydroxyhexanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2S,3R)-3-amino-2-hydroxyhexanoic acid (CAS 75638-59-4) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2S,3R)-3-amino-2-hydroxyhexanoic acid. InChIKey: OIFGOYXLBOWNGQ-UHNVWZDZSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2S,3R)-3-amino-2-hydroxyhexanoic acid |
| InChIKey | OIFGOYXLBOWNGQ-UHNVWZDZSA-N |
| SMILES | CCC[C@H]([C@@H](C(=O)O)O)N |
Computed by PubChem (NCBI)