CAS 756426-58-1 is the registry number for Ethanesulfonic acid Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexoxy)-1,1,2,2-tetrafluoroethanesulfonic acid (CAS 756426-58-1) is a chemical compound with the molecular formula C8HClF16O4S and a molecular weight of 532.58 g/mol. IUPAC name: 2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexoxy)-1,1,2,2-tetrafluoroethanesulfonic acid. InChIKey: GGOUUEMCWBTDMT-UHFFFAOYSA-N.
| Molecular formula | C8HClF16O4S |
|---|---|
| Molecular weight | 532.58 g/mol |
| IUPAC name | 2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
| InChIKey | GGOUUEMCWBTDMT-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)Cl)(F)F)(F)F)(C(C(OC(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)