CAS 756524-88-6 appears in our catalog under these names: 1-Methyl-4-Nitroso-Piperazine-d4, N-Methyl-N’-nitrosopiperazine-d4, >95% (GC), N-Methyl-N'-nitrosopiperazine-d4, >95% (GC), N-Methyl-N’-nitrosopiperazine-d4 (1 mg/mL in Methanol), N–Methyl–N'–nitrosopiperazine–d4. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 5mg, 1x1ml, 5 mg.
2,2,6,6-tetradeuterio-4-methyl-1-nitrosopiperazine (CAS 756524-88-6) is a chemical compound with the molecular formula C5H11N3O and a molecular weight of 133.19 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-4-methyl-1-nitrosopiperazine. InChIKey: CEAIOKFZXJMDAS-CQOLUAMGSA-N.
| Molecular formula | C5H11N3O |
|---|---|
| Molecular weight | 133.19 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-4-methyl-1-nitrosopiperazine |
| InChIKey | CEAIOKFZXJMDAS-CQOLUAMGSA-N |
| SMILES | [2H]C1(CN(CC(N1N=O)([2H])[2H])C)[2H] |
Computed by PubChem (NCBI)