CAS 75659-08-4 appears in our catalog under these names: (R,R)-Labetalol HCl, Labetalol Hydrochloride Impurity 21((R,R)-Labetalol Hydrochloride), (R,R)-Labetalol Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]benzamide;hydrochloride (CAS 75659-08-4) is a chemical compound with the molecular formula C19H25ClN2O3 and a molecular weight of 364.9 g/mol. IUPAC name: 2-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]benzamide;hydrochloride. InChIKey: WQVZLXWQESQGIF-WJKBNZMCSA-N.
| Molecular formula | C19H25ClN2O3 |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | 2-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]benzamide;hydrochloride |
| InChIKey | WQVZLXWQESQGIF-WJKBNZMCSA-N |
| SMILES | C[C@H](CCC1=CC=CC=C1)NC[C@@H](C2=CC(=C(C=C2)O)C(=O)N)O.Cl |
Computed by PubChem (NCBI)